C16H20ClF3N2O2 — CID 90650438
2-chloro-N-[[1-(2-hydroxyethyl)piperidin-4-yl]methyl]-5-(trifluoromethyl)benzamide (PubChem CID 90650438) has the molecular formula C16H20ClF3N2O2 and a molecular weight of 364.80 g/mol. Its IUPAC name is 2-chloro-N-[[1-(2-hydroxyethyl)piperidin-4-yl]methyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[[1-(2-hydroxyethyl)piperidin-4-yl]methyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90650438 |
| Molecular Formula | C16H20ClF3N2O2 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-chloro-N-[[1-(2-hydroxyethyl)piperidin-4-yl]methyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1CCN(CCO)CC1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H20ClF3N2O2/c17-14-2-1-12(16(18,19)20)9-13(14)15(24)21-10-11-3-5-22(6-4-11)7-8-23/h1-2,9,11,23H,3-8,10H2,(H,21,24) |
| InChIKey | CQLFEZUFDORLRZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |