C21H22ClF3N2O — CID 59186865
N-[4-(anilinomethyl)cyclohexyl]-2-chloro-5-(trifluoromethyl)benzamide (PubChem CID 59186865) has the molecular formula C21H22ClF3N2O and a molecular weight of 410.87 g/mol. Its IUPAC name is N-[4-(anilinomethyl)cyclohexyl]-2-chloro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(anilinomethyl)cyclohexyl]-2-chloro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 59186865 |
| Molecular Formula | C21H22ClF3N2O |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[4-(anilinomethyl)cyclohexyl]-2-chloro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCC(CNc2ccccc2)CC1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C21H22ClF3N2O/c22-19-11-8-15(21(23,24)25)12-18(19)20(28)27-17-9-6-14(7-10-17)13-26-16-4-2-1-3-5-16/h1-5,8,11-12,14,17,26H,6-7,9-10,13H2,(H,27,28) |
| InChIKey | LYGMVXMHRDGOJK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |