C23H26ClF3N2O2 — CID 44815772
2-chloro-N-[4-[(4-ethoxyanilino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide (PubChem CID 44815772) has the molecular formula C23H26ClF3N2O2 and a molecular weight of 454.92 g/mol. Its IUPAC name is 2-chloro-N-[4-[(4-ethoxyanilino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[4-[(4-ethoxyanilino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44815772 |
| Molecular Formula | C23H26ClF3N2O2 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-chloro-N-[4-[(4-ethoxyanilino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
| SMILES | CCOc1ccc(NCC2CCC(NC(=O)c3cc(C(F)(F)F)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C23H26ClF3N2O2/c1-2-31-19-10-8-17(9-11-19)28-14-15-3-6-18(7-4-15)29-22(30)20-13-16(23(25,26)27)5-12-21(20)24/h5,8-13,15,18,28H,2-4,6-7,14H2,1H3,(H,29,30) |
| InChIKey | PBESRZUHUIKIKU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|