C24H25ClF3N3O — CID 143937083
2-chloro-N-[4-[[3-ethenyl-4-(methylideneamino)anilino]methyl]cyclohexyl]-5-(trifluoromethyl)benzamide (PubChem CID 143937083) has the molecular formula C24H25ClF3N3O and a molecular weight of 463.93 g/mol. Its IUPAC name is 2-chloro-N-[4-[[3-ethenyl-4-(methylideneamino)anilino]methyl]cyclohexyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[4-[[3-ethenyl-4-(methylideneamino)anilino]methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 143937083 |
| Molecular Formula | C24H25ClF3N3O |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-chloro-N-[4-[[3-ethenyl-4-(methylideneamino)anilino]methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
| SMILES | C=Cc1cc(NCC2CCC(NC(=O)c3cc(C(F)(F)F)ccc3Cl)CC2)ccc1N=C |
| InChI | InChI=1S/C24H25ClF3N3O/c1-3-16-12-19(9-11-22(16)29-2)30-14-15-4-7-18(8-5-15)31-23(32)20-13-17(24(26,27)28)6-10-21(20)25/h3,6,9-13,15,18,30H,1-2,4-5,7-8,14H2,(H,31,32) |
| InChIKey | BBPMTIRXIUCKEY-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|