C16H16ClF6NO4S — CID 86656575
[4-[[2-chloro-5-(trifluoromethyl)benzoyl]amino]cyclohexyl]methyl trifluoromethanesulfonate (PubChem CID 86656575) has the molecular formula C16H16ClF6NO4S and a molecular weight of 467.82 g/mol. Its IUPAC name is [4-[[2-chloro-5-(trifluoromethyl)benzoyl]amino]cyclohexyl]methyl trifluoromethanesulfonate.
| Compound Name | [4-[[2-chloro-5-(trifluoromethyl)benzoyl]amino]cyclohexyl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86656575 |
| Molecular Formula | C16H16ClF6NO4S |
| Molecular Weight | 467.82 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | [4-[[2-chloro-5-(trifluoromethyl)benzoyl]amino]cyclohexyl]methyl trifluoromethanesulfonate |
| SMILES | O=C(NC1CCC(COS(=O)(=O)C(F)(F)F)CC1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H16ClF6NO4S/c17-13-6-3-10(15(18,19)20)7-12(13)14(25)24-11-4-1-9(2-5-11)8-28-29(26,27)16(21,22)23/h3,6-7,9,11H,1-2,4-5,8H2,(H,24,25) |
| InChIKey | NDTJLWCFULCDNA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.82 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|