C16H21ClFNO — CID 167056111
2-chloro-N-cyclohexyl-5-(2-fluoropropan-2-yl)benzamide (PubChem CID 167056111) has the molecular formula C16H21ClFNO and a molecular weight of 297.80 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-(2-fluoropropan-2-yl)benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-(2-fluoropropan-2-yl)benzamide |
|---|---|
| PubChem CID | 167056111 |
| Molecular Formula | C16H21ClFNO |
| Molecular Weight | 297.80 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-(2-fluoropropan-2-yl)benzamide |
| SMILES | CC(C)(F)c1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C16H21ClFNO/c1-16(2,18)11-8-9-14(17)13(10-11)15(20)19-12-6-4-3-5-7-12/h8-10,12H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | KJDWUTNSRXSUDN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.80 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |