C20H26Cl2N2O2 — CID 23880547
4,5-dichloro-1-N,2-N-dicyclohexylbenzene-1,2-dicarboxamide (PubChem CID 23880547) has the molecular formula C20H26Cl2N2O2 and a molecular weight of 397.35 g/mol. Its IUPAC name is 4,5-dichloro-1-N,2-N-dicyclohexylbenzene-1,2-dicarboxamide.
| Compound Name | 4,5-dichloro-1-N,2-N-dicyclohexylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 23880547 |
| Molecular Formula | C20H26Cl2N2O2 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4,5-dichloro-1-N,2-N-dicyclohexylbenzene-1,2-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(Cl)c(Cl)cc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H26Cl2N2O2/c21-17-11-15(19(25)23-13-7-3-1-4-8-13)16(12-18(17)22)20(26)24-14-9-5-2-6-10-14/h11-14H,1-10H2,(H,23,25)(H,24,26) |
| InChIKey | BJGNFOIXDIFJPJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |