C16H17F6NO — CID 154183333
N-cycloheptyl-2,5-bis(trifluoromethyl)benzamide (PubChem CID 154183333) has the molecular formula C16H17F6NO and a molecular weight of 353.31 g/mol. Its IUPAC name is N-cycloheptyl-2,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-cycloheptyl-2,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 154183333 |
| Molecular Formula | C16H17F6NO |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-cycloheptyl-2,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCCCCC1)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H17F6NO/c17-15(18,19)10-7-8-13(16(20,21)22)12(9-10)14(24)23-11-5-3-1-2-4-6-11/h7-9,11H,1-6H2,(H,23,24) |
| InChIKey | AVOSKJACAJGDHW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |