C20H27BF3NO3 — CID 167713480
N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzamide (PubChem CID 167713480) has the molecular formula C20H27BF3NO3 and a molecular weight of 397.25 g/mol. Its IUPAC name is N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 167713480 |
| Molecular Formula | C20H27BF3NO3 |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzamide |
| SMILES | CC1(C)OB(c2ccc(C(=O)NC3CCCCC3)c(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C20H27BF3NO3/c1-18(2)19(3,4)28-21(27-18)13-10-11-15(16(12-13)20(22,23)24)17(26)25-14-8-6-5-7-9-14/h10-12,14H,5-9H2,1-4H3,(H,25,26) |
| InChIKey | PBGLQHXUQOQNJL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|