C18H25BF3NO4S — CID 165368859
N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 165368859) has the molecular formula C18H25BF3NO4S and a molecular weight of 419.27 g/mol. Its IUPAC name is N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 165368859 |
| Molecular Formula | C18H25BF3NO4S |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC1(C)OB(c2ccc(S(=O)(=O)NC3CCCC3)cc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C18H25BF3NO4S/c1-16(2)17(3,4)27-19(26-16)15-10-9-13(11-14(15)18(20,21)22)28(24,25)23-12-7-5-6-8-12/h9-12,23H,5-8H2,1-4H3 |
| InChIKey | RVXPFEHZNYOLDP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|