C16H21BF6O2 — CID 171507112
2-[2,4-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane (PubChem CID 171507112) has the molecular formula C16H21BF6O2 and a molecular weight of 370.14 g/mol. Its IUPAC name is 2-[2,4-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane.
| Compound Name | 2-[2,4-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
|---|---|
| PubChem CID | 171507112 |
| Molecular Formula | C16H21BF6O2 |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[2,4-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
| SMILES | CC.CC1(C)OB(c2ccc(C(F)(F)F)cc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C14H15BF6O2.C2H6/c1-11(2)12(3,4)23-15(22-11)10-6-5-8(13(16,17)18)7-9(10)14(19,20)21;1-2/h5-7H,1-4H3;1-2H3 |
| InChIKey | ILHUPKDUTSBNMQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|