C19H30BF3O2Si — CID 101476740
triethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]silane (PubChem CID 101476740) has the molecular formula C19H30BF3O2Si and a molecular weight of 386.34 g/mol. Its IUPAC name is triethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]silane.
| Compound Name | triethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]silane |
|---|---|
| PubChem CID | 101476740 |
| Molecular Formula | C19H30BF3O2Si |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | triethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]silane |
| SMILES | CC[Si](CC)(CC)c1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H30BF3O2Si/c1-8-26(9-2,10-3)16-13-14(19(21,22)23)11-12-15(16)20-24-17(4,5)18(6,7)25-20/h11-13H,8-10H2,1-7H3 |
| InChIKey | RXDPXASGVYLRIV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|