C23H26BF3O3 — CID 140866718
cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[3-(trifluoromethyl)phenyl]methanol (PubChem CID 140866718) has the molecular formula C23H26BF3O3 and a molecular weight of 418.26 g/mol. Its IUPAC name is cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[3-(trifluoromethyl)phenyl]methanol.
| Compound Name | cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 140866718 |
| Molecular Formula | C23H26BF3O3 |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[3-(trifluoromethyl)phenyl]methanol |
| SMILES | CC1(C)OB(c2ccc(C(O)(c3cccc(C(F)(F)F)c3)C3CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C23H26BF3O3/c1-20(2)21(3,4)30-24(29-20)19-12-10-16(11-13-19)22(28,15-8-9-15)17-6-5-7-18(14-17)23(25,26)27/h5-7,10-15,28H,8-9H2,1-4H3 |
| InChIKey | RFEOPSCUBPCWLE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|