C22H29BO3 — CID 149430474
1-(3-methylphenyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol (PubChem CID 149430474) has the molecular formula C22H29BO3 and a molecular weight of 352.28 g/mol. Its IUPAC name is 1-(3-methylphenyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol.
| Compound Name | 1-(3-methylphenyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 149430474 |
| Molecular Formula | C22H29BO3 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-(3-methylphenyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol |
| SMILES | CCC(O)(c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C22H29BO3/c1-7-22(24,18-10-8-9-16(2)15-18)17-11-13-19(14-12-17)23-25-20(3,4)21(5,6)26-23/h8-15,24H,7H2,1-6H3 |
| InChIKey | YUYLKWVZQNNJGX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|