C22H29BO4 — CID 161334961
1-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(3-methylphenyl)ethanol (PubChem CID 161334961) has the molecular formula C22H29BO4 and a molecular weight of 368.28 g/mol. Its IUPAC name is 1-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(3-methylphenyl)ethanol.
| Compound Name | 1-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(3-methylphenyl)ethanol |
|---|---|
| PubChem CID | 161334961 |
| Molecular Formula | C22H29BO4 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(3-methylphenyl)ethanol |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1C(C)(O)c1cccc(C)c1 |
| InChI | InChI=1S/C22H29BO4/c1-15-9-8-10-16(13-15)22(6,24)18-12-11-17(14-19(18)25-7)23-26-20(2,3)21(4,5)27-23/h8-14,24H,1-7H3 |
| InChIKey | VLXIGUQYNQLKGQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|