C20H26BNO3 — CID 140869020
N-benzyl-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 140869020) has the molecular formula C20H26BNO3 and a molecular weight of 339.24 g/mol. Its IUPAC name is N-benzyl-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-benzyl-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 140869020 |
| Molecular Formula | C20H26BNO3 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-benzyl-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1NCc1ccccc1 |
| InChI | InChI=1S/C20H26BNO3/c1-19(2)20(3,4)25-21(24-19)16-11-12-17(18(13-16)23-5)22-14-15-9-7-6-8-10-15/h6-13,22H,14H2,1-5H3 |
| InChIKey | VOXSHRNHKVCFEB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|