C22H28BNO5 — CID 140927921
2-methoxy-N-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide (PubChem CID 140927921) has the molecular formula C22H28BNO5 and a molecular weight of 397.28 g/mol. Its IUPAC name is 2-methoxy-N-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide.
| Compound Name | 2-methoxy-N-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 140927921 |
| Molecular Formula | C22H28BNO5 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-methoxy-N-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1CNC(=O)c1ccccc1OC |
| InChI | InChI=1S/C22H28BNO5/c1-21(2)22(3,4)29-23(28-21)16-12-11-15(19(13-16)27-6)14-24-20(25)17-9-7-8-10-18(17)26-5/h7-13H,14H2,1-6H3,(H,24,25) |
| InChIKey | JOTJYYZSBNLRHP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|