C17H25BO5 — CID 131483713
methyl 3-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate (PubChem CID 131483713) has the molecular formula C17H25BO5 and a molecular weight of 320.19 g/mol. Its IUPAC name is methyl 3-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate.
| Compound Name | methyl 3-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 131483713 |
| Molecular Formula | C17H25BO5 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | methyl 3-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(B2OC(C)(C)C(C)(C)O2)cc1OC |
| InChI | InChI=1S/C17H25BO5/c1-16(2)17(3,4)23-18(22-16)13-9-7-12(14(11-13)20-5)8-10-15(19)21-6/h7,9,11H,8,10H2,1-6H3 |
| InChIKey | RVDXHIOMINLCBB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|