C32H37BN2O10 — CID 140662692
[2-methoxy-4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxycarbonylamino]phenyl]methyl N-(4-formyl-3-methoxyphenyl)carbamate (PubChem CID 140662692) has the molecular formula C32H37BN2O10 and a molecular weight of 620.46 g/mol. Its IUPAC name is [2-methoxy-4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxycarbonylamino]phenyl]methyl N-(4-formyl-3-methoxyphenyl)carbamate.
| Compound Name | [2-methoxy-4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxycarbonylamino]phenyl]methyl N-(4-formyl-3-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 140662692 |
| Molecular Formula | C32H37BN2O10 |
| Molecular Weight | 620.46 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | [2-methoxy-4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxycarbonylamino]phenyl]methyl N-(4-formyl-3-methoxyphenyl)carbamate |
| SMILES | COc1cc(NC(=O)OCc2ccc(NC(=O)OCc3ccc(B4OC(C)(C)C(C)(C)O4)cc3OC)cc2OC)ccc1C=O |
| InChI | InChI=1S/C32H37BN2O10/c1-31(2)32(3,4)45-33(44-31)23-11-8-21(26(14-23)39-5)18-42-30(38)35-25-13-10-22(28(16-25)41-7)19-43-29(37)34-24-12-9-20(17-36)27(15-24)40-6/h8-17H,18-19H2,1-7H3,(H,34,37)(H,35,38) |
| InChIKey | YOCNWUIFPHXKJG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|