C23H32BNO4 — CID 171823999
ethane;(4-methylphenyl)methyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 171823999) has the molecular formula C23H32BNO4 and a molecular weight of 397.32 g/mol. Its IUPAC name is ethane;(4-methylphenyl)methyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | ethane;(4-methylphenyl)methyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 171823999 |
| Molecular Formula | C23H32BNO4 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | ethane;(4-methylphenyl)methyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | CC.Cc1ccc(COC(=O)Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C21H26BNO4.C2H6/c1-15-6-8-16(9-7-15)14-25-19(24)23-18-12-10-17(11-13-18)22-26-20(2,3)21(4,5)27-22;1-2/h6-13H,14H2,1-5H3,(H,23,24);1-2H3 |
| InChIKey | NNFKNQSFXAFDAQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|