C27H38BNO4 — CID 166116802
tert-butyl N-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]phenyl]carbamate (PubChem CID 166116802) has the molecular formula C27H38BNO4 and a molecular weight of 451.42 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]phenyl]carbamate |
|---|---|
| PubChem CID | 166116802 |
| Molecular Formula | C27H38BNO4 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | tert-butyl N-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CCCCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C27H38BNO4/c1-25(2,3)31-24(30)29-23-18-14-21(15-19-23)11-9-8-10-20-12-16-22(17-13-20)28-32-26(4,5)27(6,7)33-28/h12-19H,8-11H2,1-7H3,(H,29,30) |
| InChIKey | VXDHHXBNJSYYQH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|