C23H37BN2O5 — CID 140898727
tert-butyl N-[(2S)-1-oxo-1-(propan-2-ylamino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate (PubChem CID 140898727) has the molecular formula C23H37BN2O5 and a molecular weight of 432.37 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-1-(propan-2-ylamino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-1-(propan-2-ylamino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 140898727 |
| Molecular Formula | C23H37BN2O5 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-1-(propan-2-ylamino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)NC(=O)[C@H](Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37BN2O5/c1-15(2)25-19(27)18(26-20(28)29-21(3,4)5)14-16-10-12-17(13-11-16)24-30-22(6,7)23(8,9)31-24/h10-13,15,18H,14H2,1-9H3,(H,25,27)(H,26,28)/t18-/m0/s1 |
| InChIKey | HWCLXCPZAHJXMU-SFHVURJKSA-N |
| XLogP | 2.95 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|