C21H34BNO6 — CID 140666734
tert-butyl N-[(2R,3R)-3-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butan-2-yl]carbamate (PubChem CID 140666734) has the molecular formula C21H34BNO6 and a molecular weight of 407.32 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-3-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-3-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140666734 |
| Molecular Formula | C21H34BNO6 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | tert-butyl N-[(2R,3R)-3-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butan-2-yl]carbamate |
| SMILES | C[C@@H](O)[C@@H](COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34BNO6/c1-14(24)17(23-18(25)27-19(2,3)4)13-26-16-11-9-15(10-12-16)22-28-20(5,6)21(7,8)29-22/h9-12,14,17,24H,13H2,1-8H3,(H,23,25)/t14-,17-/m1/s1 |
| InChIKey | NYGDZJVEYIAFJR-RHSMWYFYSA-N |
| XLogP | 2.64 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|