C22H32BN3O4 — CID 70877773
tert-butyl N-[(1R)-1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate (PubChem CID 70877773) has the molecular formula C22H32BN3O4 and a molecular weight of 413.33 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 70877773 |
| Molecular Formula | C22H32BN3O4 |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | tert-butyl N-[(1R)-1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1 |
| InChI | InChI=1S/C22H32BN3O4/c1-14(25-19(27)28-20(2,3)4)18-24-13-17(26-18)15-9-11-16(12-10-15)23-29-21(5,6)22(7,8)30-23/h9-14H,1-8H3,(H,24,26)(H,25,27)/t14-/m1/s1 |
| InChIKey | BGNFRZKHKPIZIB-CQSZACIVSA-N |
| XLogP | 3.96 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|