C19H30BNO4 — CID 142432978
tert-butyl N-[(1S)-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate (PubChem CID 142432978) has the molecular formula C19H30BNO4 and a molecular weight of 347.26 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 142432978 |
| Molecular Formula | C19H30BNO4 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | tert-butyl N-[(1S)-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H30BNO4/c1-13(21-16(22)23-17(2,3)4)14-11-9-10-12-15(14)20-24-18(5,6)19(7,8)25-20/h9-13H,1-8H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | ULIOYANVXOIJHO-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|