C20H35BO3Si — CID 102396896
tert-butyl-dimethyl-[1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethoxy]silane (PubChem CID 102396896) has the molecular formula C20H35BO3Si and a molecular weight of 362.40 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethoxy]silane |
|---|---|
| PubChem CID | 102396896 |
| Molecular Formula | C20H35BO3Si |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | tert-butyl-dimethyl-[1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethoxy]silane |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)c1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H35BO3Si/c1-15(22-25(9,10)18(2,3)4)16-13-11-12-14-17(16)21-23-19(5,6)20(7,8)24-21/h11-15H,1-10H3 |
| InChIKey | GMGRVWNETCWZOG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|