C14H22F2OSi — CID 91734918
tert-butyl-[1-(2,6-difluorophenyl)ethoxy]-dimethylsilane (PubChem CID 91734918) has the molecular formula C14H22F2OSi and a molecular weight of 272.41 g/mol. Its IUPAC name is tert-butyl-[1-(2,6-difluorophenyl)ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-(2,6-difluorophenyl)ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 91734918 |
| Molecular Formula | C14H22F2OSi |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | tert-butyl-[1-(2,6-difluorophenyl)ethoxy]-dimethylsilane |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)c1c(F)cccc1F |
| InChI | InChI=1S/C14H22F2OSi/c1-10(17-18(5,6)14(2,3)4)13-11(15)8-7-9-12(13)16/h7-10H,1-6H3 |
| InChIKey | VLMDSXVELNRKEX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|