C12H16F2O — CID 91717246
1,3-difluoro-2-[1-(2-methylpropoxy)ethyl]benzene (PubChem CID 91717246) has the molecular formula C12H16F2O and a molecular weight of 214.25 g/mol. Its IUPAC name is 1,3-difluoro-2-[1-(2-methylpropoxy)ethyl]benzene.
| Compound Name | 1,3-difluoro-2-[1-(2-methylpropoxy)ethyl]benzene |
|---|---|
| PubChem CID | 91717246 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1,3-difluoro-2-[1-(2-methylpropoxy)ethyl]benzene |
| SMILES | CC(C)COC(C)c1c(F)cccc1F |
| InChI | InChI=1S/C12H16F2O/c1-8(2)7-15-9(3)12-10(13)5-4-6-11(12)14/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | LZKVFWOMCJBGSZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |