C10H12F2S — CID 83925324
3-(2,6-difluorophenyl)butane-1-thiol (PubChem CID 83925324) has the molecular formula C10H12F2S and a molecular weight of 202.27 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)butane-1-thiol.
| Compound Name | 3-(2,6-difluorophenyl)butane-1-thiol |
|---|---|
| PubChem CID | 83925324 |
| Molecular Formula | C10H12F2S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-(2,6-difluorophenyl)butane-1-thiol |
| SMILES | CC(CCS)c1c(F)cccc1F |
| InChI | InChI=1S/C10H12F2S/c1-7(5-6-13)10-8(11)3-2-4-9(10)12/h2-4,7,13H,5-6H2,1H3 |
| InChIKey | FFPHYLICIALTLQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|