C11H10F2 — CID 83925354
1,3-difluoro-2-pent-4-yn-2-ylbenzene (PubChem CID 83925354) has the molecular formula C11H10F2 and a molecular weight of 180.20 g/mol. Its IUPAC name is 1,3-difluoro-2-pent-4-yn-2-ylbenzene.
| Compound Name | 1,3-difluoro-2-pent-4-yn-2-ylbenzene |
|---|---|
| PubChem CID | 83925354 |
| Molecular Formula | C11H10F2 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1,3-difluoro-2-pent-4-yn-2-ylbenzene |
| SMILES | C#CCC(C)c1c(F)cccc1F |
| InChI | InChI=1S/C11H10F2/c1-3-5-8(2)11-9(12)6-4-7-10(11)13/h1,4,6-8H,5H2,2H3 |
| InChIKey | XMANRITUBMXVIQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|