C12H14F2 — CID 83925405
1,3-difluoro-2-[(Z)-hex-4-en-2-yl]benzene (PubChem CID 83925405) has the molecular formula C12H14F2 and a molecular weight of 196.24 g/mol. Its IUPAC name is 1,3-difluoro-2-[(Z)-hex-4-en-2-yl]benzene.
| Compound Name | 1,3-difluoro-2-[(Z)-hex-4-en-2-yl]benzene |
|---|---|
| PubChem CID | 83925405 |
| Molecular Formula | C12H14F2 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1,3-difluoro-2-[(Z)-hex-4-en-2-yl]benzene |
| SMILES | C/C=C\CC(C)c1c(F)cccc1F |
| InChI | InChI=1S/C12H14F2/c1-3-4-6-9(2)12-10(13)7-5-8-11(12)14/h3-5,7-9H,6H2,1-2H3/b4-3- |
| InChIKey | MHAXPGXSHOEBRT-ARJAWSKDSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|