C10H11BrF2 — CID 83925329
2-(4-bromobutan-2-yl)-1,3-difluorobenzene (PubChem CID 83925329) has the molecular formula C10H11BrF2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 2-(4-bromobutan-2-yl)-1,3-difluorobenzene.
| Compound Name | 2-(4-bromobutan-2-yl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 83925329 |
| Molecular Formula | C10H11BrF2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-(4-bromobutan-2-yl)-1,3-difluorobenzene |
| SMILES | CC(CCBr)c1c(F)cccc1F |
| InChI | InChI=1S/C10H11BrF2/c1-7(5-6-11)10-8(12)3-2-4-9(10)13/h2-4,7H,5-6H2,1H3 |
| InChIKey | ZZVXSKIBVOZXDI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|