C12H19FN2 — CID 117300770
2-(4-aminobutan-2-yl)-3-fluoro-N,N-dimethylaniline (PubChem CID 117300770) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-(4-aminobutan-2-yl)-3-fluoro-N,N-dimethylaniline.
| Compound Name | 2-(4-aminobutan-2-yl)-3-fluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 117300770 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-(4-aminobutan-2-yl)-3-fluoro-N,N-dimethylaniline |
| SMILES | CC(CCN)c1c(F)cccc1N(C)C |
| InChI | InChI=1S/C12H19FN2/c1-9(7-8-14)12-10(13)5-4-6-11(12)15(2)3/h4-6,9H,7-8,14H2,1-3H3 |
| InChIKey | SGRNJFAMXFWIMA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |