C11H11F2NO — CID 60903674
1-(2,6-difluorophenyl)-2-(prop-2-ynylamino)ethanol (PubChem CID 60903674) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-(prop-2-ynylamino)ethanol.
| Compound Name | 1-(2,6-difluorophenyl)-2-(prop-2-ynylamino)ethanol |
|---|---|
| PubChem CID | 60903674 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-(prop-2-ynylamino)ethanol |
| SMILES | C#CCNCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C11H11F2NO/c1-2-6-14-7-10(15)11-8(12)4-3-5-9(11)13/h1,3-5,10,14-15H,6-7H2 |
| InChIKey | VATCMPNDPQZXHQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|