C10H11F4NO — CID 115406681
2-(2,2-difluoroethylamino)-1-(2,6-difluorophenyl)ethanol (PubChem CID 115406681) has the molecular formula C10H11F4NO and a molecular weight of 237.20 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-1-(2,6-difluorophenyl)ethanol.
| Compound Name | 2-(2,2-difluoroethylamino)-1-(2,6-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 115406681 |
| Molecular Formula | C10H11F4NO |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-1-(2,6-difluorophenyl)ethanol |
| SMILES | OC(CNCC(F)F)c1c(F)cccc1F |
| InChI | InChI=1S/C10H11F4NO/c11-6-2-1-3-7(12)10(6)8(16)4-15-5-9(13)14/h1-3,8-9,15-16H,4-5H2 |
| InChIKey | ZRKSBPGNYVFGEX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |