C13H13F2NO2 — CID 115644826
1-(2,6-difluorophenyl)-2-(furan-3-ylmethylamino)ethanol (PubChem CID 115644826) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-(furan-3-ylmethylamino)ethanol.
| Compound Name | 1-(2,6-difluorophenyl)-2-(furan-3-ylmethylamino)ethanol |
|---|---|
| PubChem CID | 115644826 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-(furan-3-ylmethylamino)ethanol |
| SMILES | OC(CNCc1ccoc1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H13F2NO2/c14-10-2-1-3-11(15)13(10)12(17)7-16-6-9-4-5-18-8-9/h1-5,8,12,16-17H,6-7H2 |
| InChIKey | KBNQDPBCXPUMHU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |