C14H13ClF2N2O — CID 110898133
2-[(6-chloro-3-pyridinyl)methylamino]-1-(2,6-difluorophenyl)ethanol (PubChem CID 110898133) has the molecular formula C14H13ClF2N2O and a molecular weight of 298.72 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methylamino]-1-(2,6-difluorophenyl)ethanol.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methylamino]-1-(2,6-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 110898133 |
| Molecular Formula | C14H13ClF2N2O |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methylamino]-1-(2,6-difluorophenyl)ethanol |
| SMILES | OC(CNCc1ccc(Cl)nc1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H13ClF2N2O/c15-13-5-4-9(7-19-13)6-18-8-12(20)14-10(16)2-1-3-11(14)17/h1-5,7,12,18,20H,6,8H2 |
| InChIKey | HQDHCLRKWDXVCQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|