C9H15Cl2N3 — CID 86584506
N'-[(6-chloro-3-pyridinyl)methyl]propane-1,3-diamine;hydrochloride (PubChem CID 86584506) has the molecular formula C9H15Cl2N3 and a molecular weight of 236.15 g/mol. Its IUPAC name is N'-[(6-chloro-3-pyridinyl)methyl]propane-1,3-diamine;hydrochloride.
| Compound Name | N'-[(6-chloro-3-pyridinyl)methyl]propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 86584506 |
| Molecular Formula | C9H15Cl2N3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | N'-[(6-chloro-3-pyridinyl)methyl]propane-1,3-diamine;hydrochloride |
| SMILES | Cl.NCCCNCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H14ClN3.ClH/c10-9-3-2-8(7-13-9)6-12-5-1-4-11;/h2-3,7,12H,1,4-6,11H2;1H |
| InChIKey | CNSDNGUIOXYPHT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|