C9H14ClN3 — CID 21271634
N'-[(2-chloro-4-pyridinyl)methyl]propane-1,3-diamine (PubChem CID 21271634) has the molecular formula C9H14ClN3 and a molecular weight of 199.69 g/mol. Its IUPAC name is N'-[(2-chloro-4-pyridinyl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(2-chloro-4-pyridinyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 21271634 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | N'-[(2-chloro-4-pyridinyl)methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1ccnc(Cl)c1 |
| InChI | InChI=1S/C9H14ClN3/c10-9-6-8(2-5-13-9)7-12-4-1-3-11/h2,5-6,12H,1,3-4,7,11H2 |
| InChIKey | MNSXMTVFPULMDS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|