C13H25N3 — CID 145198308
ethane;N'-[(6-methyl-3-pyridinyl)methyl]butane-1,4-diamine (PubChem CID 145198308) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;N'-[(6-methyl-3-pyridinyl)methyl]butane-1,4-diamine.
| Compound Name | ethane;N'-[(6-methyl-3-pyridinyl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 145198308 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | ethane;N'-[(6-methyl-3-pyridinyl)methyl]butane-1,4-diamine |
| SMILES | CC.Cc1ccc(CNCCCCN)cn1 |
| InChI | InChI=1S/C11H19N3.C2H6/c1-10-4-5-11(9-14-10)8-13-7-3-2-6-12;1-2/h4-5,9,13H,2-3,6-8,12H2,1H3;1-2H3 |
| InChIKey | QJMJTKSVGNWPNF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|