C15H15Cl2N3O2 — CID 110900450
1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-[(6-chloro-3-pyridinyl)methyl]urea (PubChem CID 110900450) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-[(6-chloro-3-pyridinyl)methyl]urea.
| Compound Name | 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-[(6-chloro-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 110900450 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-[(6-chloro-3-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccc(Cl)nc1)NCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15Cl2N3O2/c16-12-4-2-11(3-5-12)13(21)9-20-15(22)19-8-10-1-6-14(17)18-7-10/h1-7,13,21H,8-9H2,(H2,19,20,22) |
| InChIKey | RLGOERYADGGHGX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|