C20H19ClN2O2 — CID 90497488
1-[(4-chlorophenyl)methyl]-3-(2-hydroxy-2-naphthalen-1-ylethyl)urea (PubChem CID 90497488) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(2-hydroxy-2-naphthalen-1-ylethyl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(2-hydroxy-2-naphthalen-1-ylethyl)urea |
|---|---|
| PubChem CID | 90497488 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(2-hydroxy-2-naphthalen-1-ylethyl)urea |
| SMILES | O=C(NCc1ccc(Cl)cc1)NCC(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H19ClN2O2/c21-16-10-8-14(9-11-16)12-22-20(25)23-13-19(24)18-7-3-5-15-4-1-2-6-17(15)18/h1-11,19,24H,12-13H2,(H2,22,23,25) |
| InChIKey | VVYAKIFSNCZKPY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |