C26H23NO2 — CID 95367196
N-[(2R)-2-hydroxy-2-naphthalen-1-ylethyl]-2-(4-phenylphenyl)acetamide (PubChem CID 95367196) has the molecular formula C26H23NO2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-naphthalen-1-ylethyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[(2R)-2-hydroxy-2-naphthalen-1-ylethyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 95367196 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-naphthalen-1-ylethyl]-2-(4-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)NC[C@H](O)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H23NO2/c28-25(24-12-6-10-22-9-4-5-11-23(22)24)18-27-26(29)17-19-13-15-21(16-14-19)20-7-2-1-3-8-20/h1-16,25,28H,17-18H2,(H,27,29)/t25-/m0/s1 |
| InChIKey | SSFSDSLCYJOKFZ-VWLOTQADSA-N |
| XLogP | 4.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |