C8H13NO3 — CID 104874092
(2S)-3-(furan-3-ylmethylamino)propane-1,2-diol (PubChem CID 104874092) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (2S)-3-(furan-3-ylmethylamino)propane-1,2-diol.
| Compound Name | (2S)-3-(furan-3-ylmethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 104874092 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2S)-3-(furan-3-ylmethylamino)propane-1,2-diol |
| SMILES | OC[C@@H](O)CNCc1ccoc1 |
| InChI | InChI=1S/C8H13NO3/c10-5-8(11)4-9-3-7-1-2-12-6-7/h1-2,6,8-11H,3-5H2/t8-/m0/s1 |
| InChIKey | QOEDCNLAPUQFTM-QMMMGPOBSA-N |
| XLogP | -0.28 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |