C10H18N2O — CID 62560326
N-(furan-3-ylmethyl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 62560326) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(furan-3-ylmethyl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62560326 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-(furan-3-ylmethyl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNCc1ccoc1 |
| InChI | InChI=1S/C10H18N2O/c1-9(2)12-5-4-11-7-10-3-6-13-8-10/h3,6,8-9,11-12H,4-5,7H2,1-2H3 |
| InChIKey | DIKGGHCGPBCNSB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|