C11H20N2O2 — CID 102700858
N-(furan-3-ylmethyl)-N'-(2-methoxypropyl)ethane-1,2-diamine (PubChem CID 102700858) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-N'-(2-methoxypropyl)ethane-1,2-diamine.
| Compound Name | N-(furan-3-ylmethyl)-N'-(2-methoxypropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 102700858 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-(furan-3-ylmethyl)-N'-(2-methoxypropyl)ethane-1,2-diamine |
| SMILES | COC(C)CNCCNCc1ccoc1 |
| InChI | InChI=1S/C11H20N2O2/c1-10(14-2)7-12-4-5-13-8-11-3-6-15-9-11/h3,6,9-10,12-13H,4-5,7-8H2,1-2H3 |
| InChIKey | GUOOTLLXJAJKDY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|