C15H29N3O — CID 55089726
N'-[2-(dimethylamino)ethyl]-N-(furan-3-ylmethyl)-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 55089726) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-N-(furan-3-ylmethyl)-N'-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[2-(dimethylamino)ethyl]-N-(furan-3-ylmethyl)-N'-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55089726 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-N-(furan-3-ylmethyl)-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCNCc1ccoc1)CCN(C)C |
| InChI | InChI=1S/C15H29N3O/c1-14(2)12-18(9-8-17(3)4)7-6-16-11-15-5-10-19-13-15/h5,10,13-14,16H,6-9,11-12H2,1-4H3 |
| InChIKey | QQPASANOQUPMMV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|