C16H27FO2Si — CID 140735332
tert-butyl-[(2S)-1-fluoro-3-phenylmethoxypropan-2-yl]oxy-dimethylsilane (PubChem CID 140735332) has the molecular formula C16H27FO2Si and a molecular weight of 298.47 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-fluoro-3-phenylmethoxypropan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-1-fluoro-3-phenylmethoxypropan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 140735332 |
| Molecular Formula | C16H27FO2Si |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | tert-butyl-[(2S)-1-fluoro-3-phenylmethoxypropan-2-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CF)COCc1ccccc1 |
| InChI | InChI=1S/C16H27FO2Si/c1-16(2,3)20(4,5)19-15(11-17)13-18-12-14-9-7-6-8-10-14/h6-10,15H,11-13H2,1-5H3/t15-/m1/s1 |
| InChIKey | FGTZDBUOCMYYOR-OAHLLOKOSA-N |
| XLogP | 4.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|