C21H36O4Si — CID 11825080
[(2R,3S)-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutyl]-2-methyloxiran-2-yl]methanol (PubChem CID 11825080) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is [(2R,3S)-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutyl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [(2R,3S)-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutyl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11825080 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | [(2R,3S)-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutyl]-2-methyloxiran-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CC[C@@H]1O[C@]1(C)CO)COCc1ccccc1 |
| InChI | InChI=1S/C21H36O4Si/c1-20(2,3)26(5,6)25-18(12-13-19-21(4,16-22)24-19)15-23-14-17-10-8-7-9-11-17/h7-11,18-19,22H,12-16H2,1-6H3/t18-,19+,21-/m1/s1 |
| InChIKey | SFNPJFSVQPKJJN-SVFBPWRDSA-N |
| XLogP | 4.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|