C41H56IO2PSi — CID 11228048
[(9R)-9-[tert-butyl(dimethyl)silyl]oxy-10-phenylmethoxydecyl]-triphenylphosphanium iodide (PubChem CID 11228048) has the molecular formula C41H56IO2PSi and a molecular weight of 766.86 g/mol. Its IUPAC name is [(9R)-9-[tert-butyl(dimethyl)silyl]oxy-10-phenylmethoxydecyl]-triphenylphosphanium iodide.
| Compound Name | [(9R)-9-[tert-butyl(dimethyl)silyl]oxy-10-phenylmethoxydecyl]-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 11228048 |
| Molecular Formula | C41H56IO2PSi |
| Molecular Weight | 766.86 g/mol |
| Exact Mass | 766.28 |
| IUPAC Name | [(9R)-9-[tert-butyl(dimethyl)silyl]oxy-10-phenylmethoxydecyl]-triphenylphosphanium iodide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)COCc1ccccc1.[I-] |
| InChI | InChI=1S/C41H56O2PSi.HI/c1-41(2,3)45(4,5)43-37(35-42-34-36-24-14-10-15-25-36)26-16-8-6-7-9-23-33-44(38-27-17-11-18-28-38,39-29-19-12-20-30-39)40-31-21-13-22-32-40;/h10-15,17-22,24-25,27-32,37H,6-9,16,23,26,33-35H2,1-5H3;1H/q+1;/p-1/t37-;/m1./s1 |
| InChIKey | QJGZWOIGMAKIJD-GKEJWYBXSA-M |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.86 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|